Introduction：Basic information about CAS 417721-36-9|4-chloro-7-methoxyquinoline-6-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-chloro-7-methoxyquinoline-6-carboxamide |
|---|
| CAS Number | 417721-36-9 | Molecular Weight | 236.654 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 426.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.9±28.7 °C |
|---|
Names
| Name | 4-chloro-7-methoxyquinoline-6-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 426.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9ClN2O2 |
|---|
| Molecular Weight | 236.654 |
|---|
| Flash Point | 211.9±28.7 °C |
|---|
| Exact Mass | 236.035248 |
|---|
| PSA | 66.20000 |
|---|
| LogP | 1.82 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | ZBTVNIDMGKZSGC-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2nccc(Cl)c2cc1C(N)=O |
|---|
Synonyms
| 6-Quinolinecarboxamide, 4-chloro-7-methoxy- |
| 7-methoxy-4-chloro-quinoline-6-carboxamide |
| 4-Chloro-7-methoxy-6-quinolinecarboxamide |
| 4-chloro-7-methoxy-quinoline-6-carboxylic acid amide |
| QC-5355 |
| 6-Quinolinecarboxamide,4-chloro-7-methoxy |
| Lenvatinib Impurity 2 |
