Introduction:Basic information about CAS 29133-86-6|2,5-diphenyl-4,6-pyrimidinediol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-diphenyl-4,6-pyrimidinediol |
|---|
| CAS Number | 29133-86-6 | Molecular Weight | 264.27900 |
|---|
| Density | 1.26 g/cm3 | Boiling Point | 360.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H12N2O2 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 171.6ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-hydroxy-2,5-diphenyl-1H-pyrimidin-6-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26 g/cm3 |
|---|
| Boiling Point | 360.2ºC at 760 mmHg |
|---|
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C16H12N2O2 |
|---|
| Molecular Weight | 264.27900 |
|---|
| Flash Point | 171.6ºC |
|---|
| Exact Mass | 264.09000 |
|---|
| PSA | 66.24000 |
|---|
| LogP | 3.22180 |
|---|
| InChIKey | XYXQJMOZTJTMBV-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c(-c2ccccc2)nc(O)c1-c1ccccc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 6-hydroxy-2,5-diphenylpyrimidin-4(3H)-one |
| MFCD00216578 |
| 2,5-diphenyl-1H-pyrimidine-4,6-dione |
| 2,5-Diphenyl-4,6-pyrimidinediol |
| 4,6-Dihydroxy-2,5-diphenylpyrimidine |