Introduction：Basic information about CAS 76159-92-7|5,7-Dimethoxy-1H-indole-2,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,7-Dimethoxy-1H-indole-2,3-dione |
|---|
| CAS Number | 76159-92-7 | Molecular Weight | 207.183 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5,7-Dimethoxy-1H-indole-2,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C10H9NO4 |
|---|
| Molecular Weight | 207.183 |
|---|
| Exact Mass | 207.053162 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 0.25 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | HXECXMBAFBNYRH-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)c2c(c1)C(=O)C(=O)N2 |
|---|
Synonyms
| 5,7-Dimethoxy-1H-indole-2,3-dione |
| 5,7-Dimethoxy isatin 5,7-Dimethoxy indole-2,3-dione |
| 5,7-Dimethoxy indole-2,3-dione |
| 1H-Indole-2,3-dione, 5,7-dimethoxy- |
| 1H-Indole-2,3-dione,5,7-dimethoxy |
| 5,7-dimethoxyisatin |
