Introduction：Basic information about CAS 5004-45-5|4-Phenyl-2-hydrophthalazin-1-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Phenyl-2-hydrophthalazin-1-one |
|---|
| CAS Number | 5004-45-5 | Molecular Weight | 222.24200 |
|---|
| Density | 1.193g/cm3 | Boiling Point | 406.4ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O | Melting Point | 240-244 °C(lit.) |
|---|
| MSDS | / | Flash Point | 156.8ºC |
|---|
Names
| Name | 4-phenyl-2H-phthalazin-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.193g/cm3 |
|---|
| Boiling Point | 406.4ºC at 760 mmHg |
|---|
| Melting Point | 240-244 °C(lit.) |
|---|
| Molecular Formula | C14H10N2O |
|---|
| Molecular Weight | 222.24200 |
|---|
| Flash Point | 156.8ºC |
|---|
| Exact Mass | 222.07900 |
|---|
| PSA | 45.75000 |
|---|
| LogP | 2.59010 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | XCJLBNVENUPHEA-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]nc(-c2ccccc2)c2ccccc12 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Phenylphthalazin-1(2H)-one |
| 4-Phenylphthalazin-1-one |
| 4-phenylphthalazin-1-ol |
| F3116-0061 |
| 1-phthalazinol,4-phenyl |
| 4-Phenyl-1-(2H)-phthalazinone |
| 1(2H)-Phthalazinone,4-phenyl |
| 4-Phenyl-2H-phthalazin-1-on |
| 4-phenyl-2-hydrophthalazin-1-one |
| MFCD00098272 |
