Introduction：Basic information about CAS 10023-11-7|3-Bromothiophene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Bromothiophene |
|---|
| CAS Number | 10023-11-7 | Molecular Weight | 330.33200 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 604.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 223.5ºC |
|---|
Names
| Name | 2-[(1R,3S)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 604.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O6 |
|---|
| Molecular Weight | 330.33200 |
|---|
| Flash Point | 223.5ºC |
|---|
| Exact Mass | 330.11000 |
|---|
| PSA | 100.90000 |
|---|
| LogP | 2.50010 |
|---|
| Vapour Pressure | 1.74E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | XWXZEYLPRXYHQC-TVQRCGJNSA-N |
|---|
| SMILES | CCCC1OC(CC(=O)O)CC2=C1C(=O)c1c(O)cccc1C2=O |
|---|
Synonyms
| 1H-Naphtho(2,3-c)pyran-3-acetic acid,3,4,5,10-tetrahydro-9-hydroxy-5,10-dioxo-1-propyl-,(1R-trans) |
| 1H-Naphtho[2,3-c]pyran-3-aceticacid,3,4,5,10-tetrahydro-9-hydroxy-5,10-dioxo-1-propyl-,(1R,3S) |
| (+)-deoxyfrenolicin |
| Desoxyfrenolicin |
