Introduction：Basic information about CAS 12217-43-5|1-amino-4-[[4-[(dimethylamino)methyl]phenyl]amino]anthraquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-amino-4-[[4-[(dimethylamino)methyl]phenyl]amino]anthraquinone |
|---|
| CAS Number | 12217-43-5 | Molecular Weight | 371.43200 |
|---|
| Density | 1.308g/cm3 | Boiling Point | 570ºC at 760 mmHg |
|---|
| Molecular Formula | C23H21N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 298.5ºC |
|---|
Names
| Name | 1-amino-4-[4-[(dimethylamino)methyl]anilino]anthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.308g/cm3 |
|---|
| Boiling Point | 570ºC at 760 mmHg |
|---|
| Molecular Formula | C23H21N3O2 |
|---|
| Molecular Weight | 371.43200 |
|---|
| Flash Point | 298.5ºC |
|---|
| Exact Mass | 371.16300 |
|---|
| PSA | 75.43000 |
|---|
| LogP | 4.50360 |
|---|
| Vapour Pressure | 5.25E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.703 |
|---|
| InChIKey | IVFRHOQHKQWEHJ-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)Cc1ccc(Nc2ccc(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
|---|
Synonyms
| EINECS 235-398-7 |
| 1-Amino-4-({4-[(dimethylamino)methyl]phenyl}amino)anthra-9,10-quinone |
| Basic blue 47 |
| 1-Amino-4-((4-((dimethylamino)methyl)phenyl)amino)anthraquinone |
| 1-amino-4-[4-(dimethylaminomethyl)anilino]anthracene-9,10-dione |
