Introduction:Basic information about CAS 284022-85-1|ethyl 2-(3-oxocyclohexyl)benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-(3-oxocyclohexyl)benzoate |
|---|
| CAS Number | 284022-85-1 | Molecular Weight | 246.30200 |
|---|
| Density | 1.111g/cm3 | Boiling Point | 373.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.2ºC |
|---|
Names
| Name | ethyl 2-(3-oxocyclohexyl)benzoate |
|---|
Chemical & Physical Properties
| Density | 1.111g/cm3 |
|---|
| Boiling Point | 373.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18O3 |
|---|
| Molecular Weight | 246.30200 |
|---|
| Flash Point | 164.2ºC |
|---|
| Exact Mass | 246.12600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.09000 |
|---|
| Vapour Pressure | 9.17E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | BMNKHFNMAHQJIK-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccccc1C1CCCC(=O)C1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|