Introduction:Basic information about CAS 376-71-6|5h-octafluoropentanoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5h-octafluoropentanoyl chloride |
|---|
| CAS Number | 376-71-6 | Molecular Weight | 264.50100 |
|---|
| Density | 1,67 g/cm3 | Boiling Point | 86 °C |
|---|
| Molecular Formula | C5HClF8O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 9.1ºC |
|---|
Names
| Name | 2,2,3,3,4,4,5,5-octafluoropentanoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,67 g/cm3 |
|---|
| Boiling Point | 86 °C |
|---|
| Molecular Formula | C5HClF8O |
|---|
| Molecular Weight | 264.50100 |
|---|
| Flash Point | 9.1ºC |
|---|
| Exact Mass | 263.95900 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 2.92280 |
|---|
| Index of Refraction | 1.324 |
|---|
| InChIKey | GMTHNTFUIUGECX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 3265 |
|---|
| HS Code | 2915900090 |
|---|
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5H-Octafluor-valerylchlorid |
| 5H-Octafluoropentanoyl chloride |
| 2,2,3,3,4,4,5,5-octafluoro-pentanoyl chloride |
| 5H-Octafluorovaleroyl chloride |
| 5H-octafluoro-valeryl chloride |
| MFCD00153221 |
| 2.2.3.3.4.4.5.5-Octafluor-valeriansaeurechlorid |