Introduction：Basic information about CAS 815-85-0|stannous tartrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | stannous tartrate |
|---|
| CAS Number | 815-85-0 | Molecular Weight | 266.77200 |
|---|
| Density | / | Boiling Point | 399.3ºC at 760 mmHg |
|---|
| Molecular Formula | C4H4O6Sn | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.4ºC |
|---|
Names
| Name | 2,3-dihydroxybutanedioate,tin(2+) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 399.3ºC at 760 mmHg |
|---|
| Molecular Formula | C4H4O6Sn |
|---|
| Molecular Weight | 266.77200 |
|---|
| Flash Point | 209.4ºC |
|---|
| Exact Mass | 267.90300 |
|---|
| PSA | 120.72000 |
|---|
| Appearance of Characters | Powder | off-white |
|---|
| InChIKey | XEFNPVOFXHNZFW-ZVGUSBNCSA-N |
|---|
| SMILES | O=C(O)C(O)C(O)C(=O)O.[Sn] |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | slightly soluble in water. |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| RTECS | EJ9892500 |
|---|
Synonyms
| Butanedioic acid,2,3-dihydroxy-(2R,3R)-,tin(2+) salt (1:1) |
| Stannous tartrate |
| (R-(R*,R*))-2,3-Dihydroxybutanedioic acid |
| Butanedioic acid,2,3-dihydroxy-,(R-(R*,R*))-,tin(2+) salt (1:1) |
| Lg-tartaric acid,tin (II)-Lg-tartrate |
| Tartaric acid,tin(2+) salt (1:1) |
| EINECS 212-427-1 |
| Tin (R-(R*,R*))-tartrate |
| MFCD00054358 |
| Sn(II) tartrate |
| Lg-Weinsaeure,Zinn(II)-Lg-tartrat |
