Introduction：Basic information about CAS 32665-36-4|3-[4-(2-methoxy-2-phenylethyl)piperazin-1-yl]-1-phenylpropan-1-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[4-(2-methoxy-2-phenylethyl)piperazin-1-yl]-1-phenylpropan-1-ol |
|---|
| CAS Number | 32665-36-4 | Molecular Weight | 354.48600 |
|---|
| Density | 1.095g/cm3 | Boiling Point | 489.9ºC at 760mmHg |
|---|
| Molecular Formula | C22H30N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 250.1ºC |
|---|
Names
| Name | 3-[4-(2-methoxy-2-phenylethyl)piperazin-1-yl]-1-phenylpropan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.095g/cm3 |
|---|
| Boiling Point | 489.9ºC at 760mmHg |
|---|
| Molecular Formula | C22H30N2O2 |
|---|
| Molecular Weight | 354.48600 |
|---|
| Flash Point | 250.1ºC |
|---|
| Exact Mass | 354.23100 |
|---|
| PSA | 35.94000 |
|---|
| LogP | 2.99120 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | QSRHLIUOSXVKTG-UHFFFAOYSA-N |
|---|
| SMILES | COC(CN1CCN(CCC(O)c2ccccc2)CC1)c1ccccc1 |
|---|
Synonyms
| Brovel |
| Eupneron |
| Eprozinol |
| EINECS 251-146-9 |
