Introduction:Basic information about CAS 38527-73-0|3-ethyl-3-(4-nitrophenyl)piperidine-2,6-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-ethyl-3-(4-nitrophenyl)piperidine-2,6-dione |
|---|
| CAS Number | 38527-73-0 | Molecular Weight | 262.26100 |
|---|
| Density | 1.263g/cm3 | Boiling Point | 473.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240ºC |
|---|
Names
| Name | 3-ethyl-3-(4-nitrophenyl)piperidine-2,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.263g/cm3 |
|---|
| Boiling Point | 473.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14N2O4 |
|---|
| Molecular Weight | 262.26100 |
|---|
| Flash Point | 240ºC |
|---|
| Exact Mass | 262.09500 |
|---|
| PSA | 95.48000 |
|---|
| LogP | 2.47830 |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | ZHPKYOHYUWTINN-UHFFFAOYSA-N |
|---|
| SMILES | CCC1(c2ccc([N+](=O)[O-])cc2)CCC(=O)NC1=O |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(p-Nitrophenyl)-2-ethylglutarimid |
| Nitroglutethimide |
| 2-(p-Nitrophenyl)-2-ethylglutarimide |
| 3-Aethyl-3-(4-nitro-phenyl)-piperidin-2,6-dion |
| EINECS 253-987-7 |
| 2,6-Piperidinedione,3-ethyl-3-(4-nitrophenyl) |
| p-Nitroglutethimide |
| 3-ethyl-3-(4-nitro-phenyl)-piperidine-2,6-dione |
| Glutarimide,2-ethyl-2-(p-nitrophenyl) |