Introduction：Basic information about CAS 38527-90-1|SULPROFOS OXON, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | SULPROFOS OXON |
|---|
| CAS Number | 38527-90-1 | Molecular Weight | 306.38100 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 394.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19O3PS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.6ºC |
|---|
Names
| Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-4-methylsulfanylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 394.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19O3PS2 |
|---|
| Molecular Weight | 306.38100 |
|---|
| Flash Point | 192.6ºC |
|---|
| Exact Mass | 306.05100 |
|---|
| PSA | 95.94000 |
|---|
| LogP | 5.07510 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | RJOCVOGHXDEJBC-UHFFFAOYSA-N |
|---|
| SMILES | CCCSP(=O)(OCC)Oc1ccc(SC)cc1 |
|---|
Synonyms
| O-ethyl-S-n-propyl-O-(4-methylmercapto-phenyl)-thiophosphate |
| O-ethyl S-propyl-O-(4-methylmercapto-phenyl)thionophosphate |
| Phosphorothioic acid,O-ethyl O-(4-(methylthio)phenyl) S-propyl ester |
| O-ethyl-O-(4-methylthiophenyl)-S-n-propyl phosphorothiolate |
| Sulprophos oxon |
| Sulprofos oxon |
| O-ethyl O-(4-(methylthio)phenyl)-S-n-propyl phosphorothioate |
