Introduction：Basic information about CAS 50434-36-1|2-(4-nitrophenyl)acetyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-nitrophenyl)acetyl chloride |
|---|
| CAS Number | 50434-36-1 | Molecular Weight | 199.59100 |
|---|
| Density | 1.399g/cm3 | Boiling Point | 328.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 152.7ºC |
|---|
Names
| Name | 2-(4-nitrophenyl)acetyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.399g/cm3 |
|---|
| Boiling Point | 328.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3 |
|---|
| Molecular Weight | 199.59100 |
|---|
| Flash Point | 152.7ºC |
|---|
| Exact Mass | 199.00400 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.42590 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | FYXZTVPBFJQFBO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)Cc1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| p-nitrophenylacetyl chloride |
| Benzeneacetyl chloride,4-nitro |
| p-nitrobenzyl chloroformate |
| 4-Nitrobenzeneacetyl chloride |
| 4-nitrophenylacetyl chloride |
| 4-nitrophenylacetic acid chloride |
