Introduction:Basic information about CAS 287194-31-4|2-(6-Methoxy-3-oxocyclohexa-1,4-dienylcarbamoyl)phenyl acetate compound with, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(6-Methoxy-3-oxocyclohexa-1,4-dienylcarbamoyl)phenyl acetate compound with MethoxyMethane (1:1) |
|---|
| CAS Number | 287194-31-4 | Molecular Weight | 301.29400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H15NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [2-[(6-methoxy-3-oxocyclohexa-1,4-dien-1-yl)carbamoyl]phenyl] acetate |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H15NO5 |
|---|
| Molecular Weight | 301.29400 |
|---|
| Exact Mass | 301.09500 |
|---|
| PSA | 81.70000 |
|---|
| LogP | 1.77040 |
|---|
| InChIKey | NYHYQDXXVQAQGX-UHFFFAOYSA-N |
|---|
| SMILES | COC1(OC)C=CC(=O)C=C1NC(=O)c1ccccc1OC(C)=O |
|---|