Introduction：Basic information about CAS 289686-70-0|2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid |
|---|
| CAS Number | 289686-70-0 | Molecular Weight | 300.197 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 232.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10F6O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 94.4±25.9 °C |
|---|
Names
| Name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 232.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10F6O2 |
|---|
| Molecular Weight | 300.197 |
|---|
| Flash Point | 94.4±25.9 °C |
|---|
| Exact Mass | 300.058502 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.63 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.429 |
|---|
| InChIKey | ORLKRFYFNMCQIG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C(=O)O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|---|
Synonyms
| 2-[3,5-Bis(trifluoromethyl)phenyl]-2-methylpropanoic acid |
| Benzeneacetic acid, α,α-dimethyl-3,5-bis(trifluoromethyl)- |
| 2-(3,5-bis(trifluoroMethyl)phenyl)-2-Methyl propanoic acid |
