Introduction:Basic information about CAS 894085-97-3|5-[Bis(2-methyl-2-propanyl)phosphino]-1-(1-naphthyl)-1H-pyrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[Bis(2-methyl-2-propanyl)phosphino]-1-(1-naphthyl)-1H-pyrazole |
|---|
| CAS Number | 894085-97-3 | Molecular Weight | 338.42600 |
|---|
| Density | / | Boiling Point | 466.8±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H27N2P | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 236.1±21.2 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | ditert-butyl-(2-naphthalen-1-ylpyrazol-3-yl)phosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 466.8±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H27N2P |
|---|
| Molecular Weight | 338.42600 |
|---|
| Flash Point | 236.1±21.2 °C |
|---|
| Exact Mass | 338.19100 |
|---|
| PSA | 31.41000 |
|---|
| LogP | 6.15 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| InChIKey | XJZYJFVKLNCBQF-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)P(c1ccnn1-c1cccc2ccccc12)C(C)(C)C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 5-[Bis(2-methyl-2-propanyl)phosphino]-1-(1-naphthyl)-1H-pyrazole |
| 1H-Pyrazole, 5-[bis(1,1-dimethylethyl)phosphino]-1-(1-naphthalenyl)- |
| 5-(Di-tert-butylphosphanyl)-1-(naphthalen-1-yl)-1H-pyrazole |
| 5-[bis(tert-butyl)phosphino]-1-(1-naphthalenyl)-1H-pyrazole |
| 5-(Di-t-butylphosphino)-1-(naphthalen-1-yl)-1H-pyrazole |