Introduction：Basic information about CAS 2268-46-4|1,1,1,3-tetrachloro-2,2,3,3-tetrafluoropropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,1,3-tetrachloro-2,2,3,3-tetrafluoropropane |
|---|
| CAS Number | 2268-46-4 | Molecular Weight | 253.83800 |
|---|
| Density | 1.744g/cm3 | Boiling Point | 114ºC |
|---|
| Molecular Formula | C3Cl4F4 | Melting Point | -93ºC |
|---|
| MSDS | / | Flash Point | 28.9ºC |
|---|
Names
| Name | 1,1,1,3-tetrachloro-2,2,3,3-tetrafluoropropane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.744g/cm3 |
|---|
| Boiling Point | 114ºC |
|---|
| Melting Point | -93ºC |
|---|
| Molecular Formula | C3Cl4F4 |
|---|
| Molecular Weight | 253.83800 |
|---|
| Flash Point | 28.9ºC |
|---|
| Exact Mass | 251.86900 |
|---|
| LogP | 3.82350 |
|---|
| Index of Refraction | 1.397 |
|---|
| InChIKey | IQJADVFBZGJGSI-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(Cl)C(F)(F)C(Cl)(Cl)Cl |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2903772023 |
|---|
Customs
| HS Code | 2903772023 |
|---|
| Summary | 2903772023 1,1,2,2-tetrachloro-1,3,3,3-tetrafluoropropane。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。Lowest tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,1,1,3-Tetrachlorotetrafluoropropane |
| 1,1,1,3-Tetrachlor-2,2,3,3-tetrafluor-propan |
| EINECS 218-868-6 |
| CCl3CF2CClF2 |
| CFC-214cb |
| Propane,1,1,1,3-tetrachloro-2,2,3,3-tetrafluoro |
| 1,1,1,3-tetrachloro-2,2,3,3-tetrafluoro-propane |
