Introduction:Basic information about CAS 108963-96-8|Boc-L-Pyroglutamic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-L-Pyroglutamic acid methyl ester |
|---|
| CAS Number | 108963-96-8 | Molecular Weight | 243.256 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 361.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17NO5 | Melting Point | 69-71ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 172.5±25.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | Methyl (2S)-1-(tert-butoxycarbonyl)pyroglutamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 361.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | 69-71ºC |
|---|
| Molecular Formula | C11H17NO5 |
|---|
| Molecular Weight | 243.256 |
|---|
| Flash Point | 172.5±25.9 °C |
|---|
| Exact Mass | 243.110672 |
|---|
| PSA | 72.91000 |
|---|
| LogP | -0.44 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.488 |
|---|
| InChIKey | FNTAOUUEQHKLIU-ZETCQYMHSA-N |
|---|
| SMILES | COC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H317-H319 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Hazard Codes | Xn,N |
|---|
| Risk Phrases | 36-43-50 |
|---|
| Safety Phrases | 26-36/37-61 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
| HS Code | 2933790090 |
|---|
Customs
| HS Code | 2933790090 |
|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
|---|
Synonyms
| 1-O-tert-butyl 2-O-methyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| MFCD06809720 |
| 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S)- |
| 2-Methyl 1-(2-methyl-2-propanyl) (2S)-5-oxo-1,2-pyrrolidinedicarboxylate |
| Boc-pGlu-OMe |
| Methyl (2S)-1-(tert-butoxycarbonyl)py |
| Boc-Pyr-OMe |
| Methyl Boc-L-Pyroglutamate |
| N-Boc-L-pyroglutamic acid methyl ester |
| Methyl (S)-N-(tert-butoxycarbonyl)pyroglutamate |
| Boc-L-Pyroglutamic acid methylester |
| Methyl (S)-Boc-5-pyrrolidone-2-carboxylate |
| Boc-L-Pyroglutamic acid methyl ester |
| (S)-1-tert-Butyl 2-methyl 5-oxopyrrolidine-1,2-dicarboxylate |
| 1-tert-butyl 2-methyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |