Introduction:Basic information about CAS 114396-70-2|Z-2-Me-D-Ser-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-2-Me-D-Ser-OH |
|---|
| CAS Number | 114396-70-2 | Molecular Weight | 253.251 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 483.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H15NO5 | Melting Point | 123-126 °C |
|---|
| MSDS | / | Flash Point | 246.3±28.7 °C |
|---|
Names
| Name | (S)-N-Cbz-α-MeSer(OH)-OH |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 483.7±45.0 °C at 760 mmHg |
|---|
| Melting Point | 123-126 °C |
|---|
| Molecular Formula | C12H15NO5 |
|---|
| Molecular Weight | 253.251 |
|---|
| Flash Point | 246.3±28.7 °C |
|---|
| Exact Mass | 253.095016 |
|---|
| PSA | 95.86000 |
|---|
| LogP | 1.18 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | QPGOJGJGAWHTFS-LBPRGKRZSA-N |
|---|
| SMILES | CC(CO)(NC(=O)OCc1ccccc1)C(=O)O |
|---|
Synonyms
| Z-α-MeSer(OH)-OH |
| N-carbobenzoxy-DL-α-methylserine |
| L-Serine, 2-methyl-N-[(phenylmethoxy)carbonyl]- |
| (S)-2-(benzyloxycarbonylamino)-3-hydroxy-2-methylpropanoic acid |
| N-[(Benzyloxy)carbonyl]-2-methyl-L-serine |
| Z-2-Me-D-Ser-OH |