Introduction:Basic information about CAS 6250-23-3|Phenol,4-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,4-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]- |
|---|
| CAS Number | 6250-23-3 | Molecular Weight | 302.33000 |
|---|
| Density | 1.19 g/cm3 | Boiling Point | 479.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14N4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.7ºC |
|---|
Names
| Name | p-[[p-(phenylazo)phenyl]azo]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19 g/cm3 |
|---|
| Boiling Point | 479.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H14N4O |
|---|
| Molecular Weight | 302.33000 |
|---|
| Flash Point | 243.7ºC |
|---|
| Exact Mass | 302.11700 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 6.22300 |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | RTZYVAQWQXPIAC-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(N=Nc2ccc(N=Nc3ccccc3)cc2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 4-[4-(Phenylazo)phenylazo]phenol |
| C.I. Disperse yellow 23 |
| 4-hydroxybisazobenzene |
| p-[p-phenylazophenylazo]phenol |
| 4-[[4-(phenylazo)phenyl]azo]-pheno |
| Esterquinone Light Yellow 3RLL |
| 4-hydroxy-4'-benzenazoazobenzene |
| Disperse golden yellow E-3RL |
| Laytl Yellow 4RL |
| 4-hydroxyphenylazo-4-(4-phenylazo)benzene |
| 4-<p-(phenylazo)-phenylazo>-phenol |
| 4-(4-Hydroxyphenylazo)-azobenzen |
| 4'-(Phenylazo)azobenzene-4-ol |
| Terasil Golden Yellow R |