Introduction：Basic information about CAS 303-42-4|Methenolone Enanthate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methenolone Enanthate |
|---|
| CAS Number | 303-42-4 | Molecular Weight | 414.621 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 504.3±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C27H42O3 | Melting Point | 289-292°C |
|---|
| MSDS | / | Flash Point | 213.1±30.2 °C |
|---|
Names
| Name | Methenolone enanthate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 504.3±50.0 °C at 760 mmHg |
|---|
| Melting Point | 289-292°C |
|---|
| Molecular Formula | C27H42O3 |
|---|
| Molecular Weight | 414.621 |
|---|
| Flash Point | 213.1±30.2 °C |
|---|
| Exact Mass | 414.313385 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 7.58 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | TXUICONDJPYNPY-FRXWOFFRSA-N |
|---|
| SMILES | CCCCCCC(=O)OC1CCC2C3CCC4CC(=O)C=C(C)C4(C)C3CCC12C |
|---|
| Storage condition | 2~8℃ |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R22:Harmful if swallowed. |
|---|
| Safety Phrases | S22-S26-S36/37/39 |
|---|
Synonyms
| SH 601 |
| Heptanoic acid, (5α,17β)-1-methyl-3-oxoandrost-1-en-17-yl ester |
| PRIMOBOLAN-DEPOT |
| MFCD00864190 |
| Delapromor |
| 5α-Androst-1-en-3-one, 17β-hydroxy-1-methyl-, heptanoate |
| Methenolone Enanhate |
| (5α,17β)-1-Methyl-3-oxoandrost-1-en-17-yl heptanoate |
| 17b-Hydroxy-1-methyl-5a-androst-1-en-3-one Heptanoate |
| Androst-1-en-3-one, 1-methyl-17-((1-oxoheptyl)oxy)-, (5α,17β)- |
| Metenolone enanthate |
| Primobolan depot |
| Methenolone 17-enanthate |
| metenoloneenantate |
| EINECS 206-141-6 |
| Androst-1-en-3-one, 1-methyl-17-[(1-oxoheptyl)oxy]-, (5α,17β)- |
| 17β-Hydroxy-1-methyl-5α-androst-1-en-3-one heptanoate |
| Primonabol Depot |
| Methenolone Enanthane |
