Introduction：Basic information about CAS 81932-04-9|4-(bromodifluoromethoxy)nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(bromodifluoromethoxy)nitrobenzene |
|---|
| CAS Number | 81932-04-9 | Molecular Weight | 268.01200 |
|---|
| Density | 1.793 g/cm3 | Boiling Point | 91ºC |
|---|
| Molecular Formula | C7H4BrF2NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.6ºC |
|---|
Names
| Name | 1-[bromo(difluoro)methoxy]-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.793 g/cm3 |
|---|
| Boiling Point | 91ºC |
|---|
| Molecular Formula | C7H4BrF2NO3 |
|---|
| Molecular Weight | 268.01200 |
|---|
| Flash Point | 123.6ºC |
|---|
| Exact Mass | 266.93400 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.44200 |
|---|
| InChIKey | JPNHCEIQOASHOX-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(OC(F)(F)Br)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| PC1393C |
| MFCD00153075 |
| p-nitro(bromodifluoromethoxy)benzene |
| 4-(Bromodifluoromethoxy)nitrobenzene |
