Introduction:Basic information about CAS 29091-09-6|2,4-Dichloro-3,5-dinitro benzotrifluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dichloro-3,5-dinitro benzotrifluoride |
|---|
| CAS Number | 29091-09-6 | Molecular Weight | 304.995 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 314.6±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7HCl2F3N2O4 | Melting Point | 76-78°C |
|---|
| MSDS | / | Flash Point | 144.1±26.5 °C |
|---|
Names
| Name | 2,4-Dichloro-3,5-dinitrobenzotrifluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 314.6±37.0 °C at 760 mmHg |
|---|
| Melting Point | 76-78°C |
|---|
| Molecular Formula | C7HCl2F3N2O4 |
|---|
| Molecular Weight | 304.995 |
|---|
| Flash Point | 144.1±26.5 °C |
|---|
| Exact Mass | 303.926544 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 3.23 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | DPQYRXNRGNLPFC-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)c([N+](=O)[O-])c1Cl |
|---|
Safety Information
| Hazard Codes | Xi: Irritant;T: Toxic; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | 2811 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,4-Dichloro-3,5-nitrobenzotrifluoride |
| Benzene, 2,4-dichloro-1,3-dinitro-5-(trifluoromethyl)- |
| 2,4-dichloro-3,5-dinitrotrifluoromethylbenzene |
| EINECS 249-420-8 |
| MFCD00042480 |
| 2,4-Dichloro-3,5-Dinitrobenzotrifluoride |
| 1,3-dichloro-2,4-dinitro-6-trifluoromethylbenzene |
| 2,4-Dichloro-3,5-din |
| 1,3-Dichloro-2,6-dinitro-4-trifluoromethylbenzene |
| 2,4-Dichloro-1,3-dinitro-5-(trifluoromethyl)benzene |
| 2,4-dichloro-1,3-dinitro-5-(trifluoromethyl)-benzen |
| BENZENE,2,4-DICHLORO-1,3-DINITRO-5-(TRIFLUOROMETHYL) |
| 2,4-Dichloro-3,5-Dinitrobenzotrifluoride/3,5-Dinitro-2,4-Dichlo |
| 2,4-Dichloro-3,5-dinitro benzotrifluoride |