Introduction：Basic information about CAS 122507-47-5|(D-Pen2,p-chloro-Phe4,D-Pen5)-Enkephalin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (D-Pen2,p-chloro-Phe4,D-Pen5)-Enkephalin |
|---|
| CAS Number | 122507-47-5 | Molecular Weight | 680.235 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1052.0±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H38ClN5O7S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 590.0±34.3 °C |
|---|
Names
| Name | (4S,7S,13S)-13-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-7-[(4-chlorophenyl)methyl]-3,3,14,14-tetramethyl-6,9,12-trioxo-1,2-dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 1052.0±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H38ClN5O7S2 |
|---|
| Molecular Weight | 680.235 |
|---|
| Flash Point | 590.0±34.3 °C |
|---|
| Exact Mass | 679.190125 |
|---|
| PSA | 250.55000 |
|---|
| LogP | 2.83 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | VTVUYFFDQHWCTJ-WMIMKTLMSA-N |
|---|
| SMILES | CC1(C)SSC(C)(C)C(NC(=O)C(N)Cc2ccc(O)cc2)C(=O)NCC(=O)NC(Cc2ccc(Cl)cc2)C(=O)NC1C(=O)O |
|---|
Synonyms
| (4S,7S,13S)-7-(4-Chlorobenzyl)-3,3,14,14-tetramethyl-6,9,12-trioxo-13-(L-tyrosylamino)-1,2-dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid |
| [D-Pen2,4'-Cl-Phe4,D-Pen5]enkephalin |
| 1,2-Dithia-5,8,11-triazacyclotetradecane-4-carboxylic acid, 13-[[(2S)-2-amino-3-(4-hydroxyphenyl)-1-oxopropyl]amino]-7-[(4-chlorophenyl)methyl]-3,3,14,14-tetramethyl-6,9,12-trioxo-, (4S,7S,13S)- |
| cyclic[D-Pen2,4'-ClPhe4,D-Pen5]enkephalin |
| cyclo[D-Pen2-4'-Cl-Phe4,D-Pen5]enkephalin |
| Dpdp(Cl)E |
| [pCl-Phe4]-DPDPE |
| Enkephalin,pen(2,5)-4-chloro-phe(4) |
| [D-Pen2,p-Cl-Phe4,D-Pen5]enkephalin |
| Pcl-dpdpe |
