Introduction:Basic information about CAS 67341-01-9|BOC-L-Phenylglycinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BOC-L-Phenylglycinol |
|---|
| CAS Number | 67341-01-9 | Molecular Weight | 237.295 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 389.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H19NO3 | Melting Point | 141.0 to 147.0 °C |
|---|
| MSDS | / | Flash Point | 189.3±25.9 °C |
|---|
Names
| Name | N-Boc-DL-Phenylglycinol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 389.4±35.0 °C at 760 mmHg |
|---|
| Melting Point | 141.0 to 147.0 °C |
|---|
| Molecular Formula | C13H19NO3 |
|---|
| Molecular Weight | 237.295 |
|---|
| Flash Point | 189.3±25.9 °C |
|---|
| Exact Mass | 237.136490 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 2.33 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | IBDIOGYTZBKRGI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CO)c1ccccc1 |
|---|
Synonyms
| N-Boc-D-2-phenylglycinol |
| Carbamic acid, N-(2-hydroxy-2-phenylethyl)-, 1,1-dimethylethyl ester |
| n-boc-d/l-phenylglycinol |
| Boc-D-Phenylglycinol |
| tert-butyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate |
| (R)-2-(tert-Butoxycarbonylamino)-2-phenylethanol |
| 2-Methyl-2-propanyl (2-hydroxy-2-phenylethyl)carbamate |
| 1,1-Dimethylethyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate |
| (R)-N-Boc-D-α-phenylglycinol |
| (R)-tert-Butyl (2-hydroxy-1-phenylethyl)carbamate |
| tert-Butyl [(1S)-2-hydroxy-1-phenylethyl]carbamate |
| Carbamic acid, N-[(1R)-2-hydroxy-1-phenylethyl]-, 1,1-dimethylethyl ester |
| N-t-BOC-D-Phenylglycinol |
| N-(tert-Butoxycarbonyl)-D-2-phenylglycinol |
| BOC-L-Phenylglycinol |
| 2-Methyl-2-propanyl [(1R)-2-hydroxy-1-phenylethyl]carbamate |
| tert-Butyl [(1R)-2-hydroxy-1-phenylethyl]carbamate |
| 2-Methyl-2-propanyl [(1S)-2-hydroxy-1-phenylethyl]carbamate |
| Carbamic acid, N-[(1S)-2-hydroxy-1-phenylethyl]-, 1,1-dimethylethyl ester |
| tert-Butyl (2-hydroxy-2-phenylethyl)carbamate |