Introduction:Basic information about CAS 38675-79-5|(4-tert-butylphenyl)(cyclopropyl)methanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-tert-butylphenyl)(cyclopropyl)methanone |
|---|
| CAS Number | 38675-79-5 | Molecular Weight | 202.292 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 303.6±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H18O | Melting Point | 56-60ºC |
|---|
| MSDS | / | Flash Point | 126.4±17.0 °C |
|---|
Names
| Name | 4-tert-Butylphenyl cyclopropyl ketone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 303.6±21.0 °C at 760 mmHg |
|---|
| Melting Point | 56-60ºC |
|---|
| Molecular Formula | C14H18O |
|---|
| Molecular Weight | 202.292 |
|---|
| Flash Point | 126.4±17.0 °C |
|---|
| Exact Mass | 202.135757 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.72 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.541 |
|---|
| InChIKey | XVDLXILLBPXUPJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccc(C(=O)C2CC2)cc1 |
|---|
Safety Information
| Safety Phrases | 24/25 |
|---|
| HS Code | 2914399090 |
|---|
Customs
| HS Code | 2914399090 |
|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| Cyclopropyl-p-tert-butylphenylketon |
| 4-tert-Butylphenyl c |
| Cyclopropyl[4-(2-methyl-2-propanyl)phenyl]methanone |
| Methanone, cyclopropyl[4-(1,1-dimethylethyl)phenyl]- |
| Cyclopropyl-<4-tert-butyl-phenyl>-keton |
| [4-(tert-butyl)phenyl](cyclopropyl)methanone |
| EINECS 254-078-8 |
| Cyclopropyl [4-(1,1-dimethylethyl)phenyl]-methanone |
| Methanone,cyclopropyl[4-(1,1-dimethylethyl)phenyl] |
| (4-tert-butylphenyl)(cyclopropyl)methanone |
| CYCLOPROPYL 4-(1,1-DIMETHYLETHYL)PHENYL-METHANONE |
| Cyclopropyl 4-tert-butylphenyl ketone |