Introduction:Basic information about CAS 29529-99-5|6-(dibutylamino)-1,3,5-triazine-2,4-dithiol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-(dibutylamino)-1,3,5-triazine-2,4-dithiol |
|---|
| CAS Number | 29529-99-5 | Molecular Weight | 272.43300 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 343.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H20N4S2 | Melting Point | 143ºC |
|---|
| MSDS | / | Flash Point | 161.7ºC |
|---|
Names
| Name | 6-(dibutylamino)-1H-1,3,5-triazine-2,4-dithione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 343.7ºC at 760mmHg |
|---|
| Melting Point | 143ºC |
|---|
| Molecular Formula | C11H20N4S2 |
|---|
| Molecular Weight | 272.43300 |
|---|
| Flash Point | 161.7ºC |
|---|
| Exact Mass | 272.11300 |
|---|
| PSA | 119.51000 |
|---|
| LogP | 2.85560 |
|---|
| Vapour Pressure | 6.9E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | IXDGHAZCSMVIFX-UHFFFAOYSA-N |
|---|
| SMILES | CCCCN(CCCC)c1nc(=S)[nH]c(=S)[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2-di-n-butylamino-1,3,5-triazine-4,6-dithiol |
| 2-n-butylamino-4,6-dimercapto-s-triazine |
| 6-(dibutylamino)-1,3,5-triazine-2,4(1H,3H)-dithione |
| 6-dibutylamino-S-triazine-2,4-dithiol |
| 2-(Dibutylamino)-4,6-dimercapto-1,3,5-triazine |
| 2-di-n-butylamino-4,6-dimercapto-s-triazine |
| EINECS 249-682-3 |
| 6-dibutylamino-1H-[1,3,5]triazine-2,4-dithione |
| 6-(Dibutylamino)-1,3,5-triazine-2,4-dithiol |