Introduction:Basic information about CAS 37777-90-5|2-(4,5-Dichloro-2-nitrophenyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4,5-Dichloro-2-nitrophenyl)acetic acid |
|---|
| CAS Number | 37777-90-5 | Molecular Weight | 250.03600 |
|---|
| Density | 1.638g/cm3 | Boiling Point | 388ºC at 760mmHg |
|---|
| Molecular Formula | C8H5Cl2NO4 | Melting Point | 127-130ºC |
|---|
| MSDS | / | Flash Point | 188.5ºC |
|---|
Names
| Name | 2-(4,5-Dichloro-2-nitrophenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.638g/cm3 |
|---|
| Boiling Point | 388ºC at 760mmHg |
|---|
| Melting Point | 127-130ºC |
|---|
| Molecular Formula | C8H5Cl2NO4 |
|---|
| Molecular Weight | 250.03600 |
|---|
| Flash Point | 188.5ºC |
|---|
| Exact Mass | 248.96000 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 3.05190 |
|---|
| InChIKey | NIBVBDGBJQMRNF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4,5-Dichloro-2-nitro-phenylacetic acid |
| 4,5-Dichlor-2-nitro-phenylessigsaeure |
| Dichloronitrophenylaceticacid |
| 2-nitro-4,5-dichlorophenylacetic acid |