Introduction:Basic information about CAS 93189-18-5|n-(7-methoxynaphthalen-1-yl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(7-methoxynaphthalen-1-yl)acetamide |
|---|
| CAS Number | 93189-18-5 | Molecular Weight | 215.24800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H13NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | n-(7-methoxynaphthalen-1-yl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H13NO2 |
|---|
| Molecular Weight | 215.24800 |
|---|
| Exact Mass | 215.09500 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 2.87980 |
|---|
| InChIKey | ROIBKRTYRRRTPJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2cccc(NC(C)=O)c2c1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(7-Methoxy-[1]naphthyl)-acetamid |
| 8-Acetamino-2-methoxy-naphthalin |
| CTK5H2180 |
| AGN-PC-009AL7 |
| 8-Acetamino-naphthol-(2)-methylaether |
| N-(7-Methoxy-1-naphthyl)acetamide |
| QC-913 |
| N-(7-methoxynaphthyl)acetamide |
| 8-acetamido-2-methoxynaphthalene |