Introduction:Basic information about CAS 41295-98-1|2,5-dichlorosulfanilic acid sodium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-dichlorosulfanilic acid sodium salt |
|---|
| CAS Number | 41295-98-1 | Molecular Weight | 264.06200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H4Cl2NNaO3S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | sodium,4-amino-2,5-dichlorobenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C6H4Cl2NNaO3S |
|---|
| Molecular Weight | 264.06200 |
|---|
| Exact Mass | 262.91900 |
|---|
| PSA | 91.60000 |
|---|
| LogP | 3.14170 |
|---|
| InChIKey | MOJYHTGMAPQZMC-UHFFFAOYSA-M |
|---|
| SMILES | Nc1cc(Cl)c(S(=O)(=O)[O-])cc1Cl.[Na+] |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22-36 |
|---|
| Safety Phrases | 26 |
|---|
| HS Code | 2921420090 |
|---|
Customs
| HS Code | 2921420090 |
|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| CTK8B1662 |
| EINECS 255-302-7 |
| Sodium 2,5-Dichlorosulfanilate |
| ACMC-209jjn |
| 2,4-DIFLUORO-3-METHOXYBENZYLAMINE |
| Sodium 2,5-Dichloroaniline-4-sulfonate |
| 2,5-Dichloroaniline-4-sulfonic Acid Sodium Salt |
| Sodium 2,5-dichlorosulphanilate |
| 2,5-Dichlorosulfanilic Acid Sodium Salt |