Introduction：Basic information about CAS 101046-20-2|AKIYAMA'S REAGENT, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | AKIYAMA'S REAGENT |
|---|
| CAS Number | 101046-20-2 | Molecular Weight | 332.35300 |
|---|
| Density | 1.327g/cm3 | Boiling Point | 528.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H16N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 273.6ºC |
|---|
Names
| Name | 1-[4-[6-(dimethylamino)-1-benzofuran-2-yl]phenyl]pyrrole-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.327g/cm3 |
|---|
| Boiling Point | 528.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H16N2O3 |
|---|
| Molecular Weight | 332.35300 |
|---|
| Flash Point | 273.6ºC |
|---|
| Exact Mass | 332.11600 |
|---|
| PSA | 53.76000 |
|---|
| LogP | 3.66020 |
|---|
| Vapour Pressure | 2.88E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | JQJNRLOLSDAAPI-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc2cc(-c3ccc(N4C(=O)C=CC4=O)cc3)oc2c1 |
|---|
Synonyms
| N-(4-(2-(6-Dimethylamino)benzofuranyl)phenyl)maleimide |
| N-<p-<2-(6-dimethylamino)benzofuranyl>phenyl>maleimide |
| 1-(4-(6-(Dimethylamino)-2-benzofuranyl)phenyl)-1H-pyrrole-2,5-dione |
| 1-{4-[6-(dimethylamino)-1-benzofuran-2-yl]phenyl}-1H-pyrrole-2,5-dione |
| N-<4-(6-dimethylamino-2-benzofuranyl)phenyl>maleimide |
| N-Dbpm |
| 1H-Pyrrole-2,5-dione,1-(4-(6-(dimethylamino)-2-benzofuranyl)phenyl) |
