Introduction：Basic information about CAS 17697-12-0|benzeneseleninic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | benzeneseleninic anhydride |
|---|
| CAS Number | 17697-12-0 | Molecular Weight | 360.12600 |
|---|
| Density | / | Boiling Point | 184.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O3Se2 | Melting Point | 165-170 °C(lit.) |
|---|
| MSDS | / | Flash Point | 65.2ºC |
|---|
Names
| Name | phenylseleninyl benzeneseleninate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 184.2ºC at 760 mmHg |
|---|
| Melting Point | 165-170 °C(lit.) |
|---|
| Molecular Formula | C12H10O3Se2 |
|---|
| Molecular Weight | 360.12600 |
|---|
| Flash Point | 65.2ºC |
|---|
| Exact Mass | 361.89600 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 0.65480 |
|---|
| Vapour Pressure | 1.02mmHg at 25°C |
|---|
| InChIKey | FHPZOWOEILXXBD-UHFFFAOYSA-N |
|---|
| SMILES | O=[Se](O[Se](=O)c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | T:Toxic;N:Dangerousfortheenvironment; |
|---|
| Risk Phrases | R23/25;R33;R50/53 |
|---|
| Safety Phrases | S20/21-S28-S45-S60-S61 |
|---|
| RIDADR | UN 3283 6.1/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| phenylseleninic anhydride |
| benzeneselenic acid anhydride |
| Benzeneseleninic acid anhydride |
| Bis(phenylseleninic) anhydride |
| EINECS 241-701-3 |
| Benzeneseleninic anhydride |
| benzeneselenic anhydride |
| [PhSe(O)]2O |
| MFCD00001991 |
