Introduction:Basic information about CAS 17823-40-4|4-Bromo-2,3,5,6-tetrafluorobenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-2,3,5,6-tetrafluorobenzonitrile |
|---|
| CAS Number | 17823-40-4 | Molecular Weight | 253.979 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 203.7±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7BrF4N | Melting Point | 77-79ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 77.0±25.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-bromo-2,3,5,6-tetrafluorobenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 203.7±35.0 °C at 760 mmHg |
|---|
| Melting Point | 77-79ºC(lit.) |
|---|
| Molecular Formula | C7BrF4N |
|---|
| Molecular Weight | 253.979 |
|---|
| Flash Point | 77.0±25.9 °C |
|---|
| Exact Mass | 252.915024 |
|---|
| PSA | 23.79000 |
|---|
| LogP | 1.58 |
|---|
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | STJZOKCIEOTPDV-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1c(F)c(F)c(Br)c(F)c1F |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | UN 3276 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 4-Bromo-2,3,5,6-tetrafluorobenzonitrile |
| MFCD00075282 |
| 4-bromotetrafluorophenyl cyanide |
| 4-bromotetrafluorobenzonitrile |
| Benzonitrile, 4-bromo-2,3,5,6-tetrafluoro- |
| 4-Bromo-2,3,5,6-Tetrafluoro-Benzonitrile |
| 4-Bromtetrafluorbenzonitril |
| PC2466 |