Introduction:Basic information about CAS 110999-36-5|3-Carbamoyl-1,4-dimethylpyridinium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Carbamoyl-1,4-dimethylpyridinium chloride |
|---|
| CAS Number | 110999-36-5 | Molecular Weight | 186.639 |
|---|
| Density | 1.063 | Boiling Point | 95ºC (15 mmHg) |
|---|
| Molecular Formula | C8H11ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 95ºC |
|---|
Names
| Name | 3-(aminocarbonyl)-1,4-dimethylpyridinium chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.063 |
|---|
| Boiling Point | 95ºC (15 mmHg) |
|---|
| Molecular Formula | C8H11ClN2O |
|---|
| Molecular Weight | 186.639 |
|---|
| Flash Point | 95ºC |
|---|
| Exact Mass | 186.055984 |
|---|
| PSA | 46.97000 |
|---|
| InChIKey | DFKMKEGJTOGPAX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc[n+](C)cc1C(N)=O.[Cl-] |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Carbamoyl-1,4-dimethylpyridinium chloride |
| Pyridinium, 3-(aminocarbonyl)-1,4-dimethyl-, chloride (1:1) |
| 1,4-diMethylpyridiniuM chloride |
| 1,4-dimethyl-3-carbamoylpyridinium |