Introduction:Basic information about CAS 19982-08-2|memantine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | memantine |
|---|
| CAS Number | 19982-08-2 | Molecular Weight | 179.302 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 239.8±8.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H22ClN | Melting Point | 153ºC |
|---|
| MSDS | / | Flash Point | 92.3±9.7 °C |
|---|
Names
| Name | memantine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 239.8±8.0 °C at 760 mmHg |
|---|
| Melting Point | 153ºC |
|---|
| Molecular Formula | C12H22ClN |
|---|
| Molecular Weight | 179.302 |
|---|
| Flash Point | 92.3±9.7 °C |
|---|
| Exact Mass | 179.167404 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 3.18 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | BUGYDGFZZOZRHP-UHFFFAOYSA-N |
|---|
| SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2 |
|---|
| Storage condition | Store at RT |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2921300090 |
|---|
Customs
| HS Code | 2921300090 |
|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Acid salts MeMantine |
| memantine |
| 3,5-Dimethyl-1-adamantylamine |
| MFCD02114015 |
| 3,5-dimethyltricyclo[3.3.1.1]decan-1-amine |
| Memantina [INN-Spanish] |
| 3,5-Dimethyl-1-adamantanamine |
| 3,5-Dimethyladamantan-1-amine |
| 1,3-Dimethylaminoadamantane |
| MEMENTINE HYDROCHHLORIDE |
| Tricyclo[3.3.1.1]decan-1-amine, 3,5-dimethyl- |
| tricyclo[3.3.1.13,7]decan-1-amine, 3,5-dimethyl- |
| 3,5-dimethyltricyclo[3.3.1.13,7]decan-1-amine |
| 3,5-Dimethyl-1-aminoadamantane |
| AURORA KA-7643 |
| 3,5-Dimethyladamantan-1-ylamine |
| 1,3-dimethyl-5-aminoadamantane |
| 1-amino-3,5-dimethyl-adamantane |