Introduction:Basic information about CAS 2379-75-1|5-chloro-2-(5-chloro-4,7-dimethyl-3-oxobenzo[b]thien-2(3H)-ylidene)-4,7-dimethy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-chloro-2-(5-chloro-4,7-dimethyl-3-oxobenzo[b]thien-2(3H)-ylidene)-4,7-dimethylbenzo[b]thiophene-3(2H)-one |
|---|
| CAS Number | 2379-75-1 | Molecular Weight | 421.36000 |
|---|
| Density | 1.499 | Boiling Point | 551.8ºC at 760 mmHg |
|---|
| Molecular Formula | C20H14Cl2O2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 287.5ºC |
|---|
Names
| Name | Vat Voilet 3 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.499 |
|---|
| Boiling Point | 551.8ºC at 760 mmHg |
|---|
| Molecular Formula | C20H14Cl2O2S2 |
|---|
| Molecular Weight | 421.36000 |
|---|
| Flash Point | 287.5ºC |
|---|
| Exact Mass | 419.98100 |
|---|
| PSA | 84.74000 |
|---|
| LogP | 6.71560 |
|---|
| Vapour Pressure | 3.19E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.719 |
|---|
| InChIKey | WNQYKPVIXDBBAO-FMQUCBEESA-N |
|---|
| SMILES | Cc1cc(Cl)c(C)c2c1SC(=C1Sc3c(C)cc(Cl)c(C)c3C1=O)C2=O |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4.4'.7.7'-Tetramethyl-5.5'-dichlorthioindigo |
| c.i. pigment violet 38 |
| Arlanon Magenta B |
| C.I. Vat Violet 3 |
| vat violet 3 |
| Navidon Magenta B. |
| Anthramar Magenta B |
| Vat Red Violet RRN |