Introduction：Basic information about CAS 886368-88-3|5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid |
|---|
| CAS Number | 886368-88-3 | Molecular Weight | 194.163 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 386.8±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7FN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.7±22.3 °C |
|---|
Names
| Name | 5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 386.8±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7FN2O2 |
|---|
| Molecular Weight | 194.163 |
|---|
| Flash Point | 187.7±22.3 °C |
|---|
| Exact Mass | 194.049149 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 1.46 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | MZEJUCPSOXTCSZ-UHFFFAOYSA-N |
|---|
| SMILES | Cn1nc(C(=O)O)c2cc(F)ccc21 |
|---|
Synonyms
| 5-Fluoro-1-methyl-1H-indazole-3-carboxylic acid |
| 1H-Indazole-3-carboxylic acid, 5-fluoro-1-methyl- |
| 5-fluoro-1-methylindazole-3-carboxylic acid |
