Introduction:Basic information about CAS 884497-37-4|ethyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate |
|---|
| CAS Number | 884497-37-4 | Molecular Weight | 275.36600 |
|---|
| Density | 1.185g/cm3 | Boiling Point | 414.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.3ºC |
|---|
Names
| Name | ethyl 2-amino-5-(1-phenylethyl)thiophene-3-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.185g/cm3 |
|---|
| Boiling Point | 414.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17NO2S |
|---|
| Molecular Weight | 275.36600 |
|---|
| Flash Point | 204.3ºC |
|---|
| Exact Mass | 275.09800 |
|---|
| PSA | 80.56000 |
|---|
| LogP | 4.24000 |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | DIXRCLQTPWTGBC-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(C(C)c2ccccc2)sc1N |
|---|