Introduction:Basic information about CAS 885269-98-7|2-[4-(2-N-Boc-amino-ethyl)-phenyl]-acetamidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-(2-N-Boc-amino-ethyl)-phenyl]-acetamidine |
|---|
| CAS Number | 885269-98-7 | Molecular Weight | 277.36200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H23N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[4-(2-n-boc-amino-ethyl)-phenyl]-acetamidine |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H23N3O2 |
|---|
| Molecular Weight | 277.36200 |
|---|
| Exact Mass | 277.17900 |
|---|
| PSA | 88.20000 |
|---|
| LogP | 3.42320 |
|---|
| InChIKey | SFKOPNLWVRHZLB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(CC(=N)N)cc1 |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|