Introduction：Basic information about CAS 6229-00-1|Ethynyl(triphenyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethynyl(triphenyl)silane |
|---|
| CAS Number | 6229-00-1 | Molecular Weight | 284.427 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 365.2±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H16Si | Melting Point | 48-50ºC(lit.) |
|---|
| MSDS | / | Flash Point | 173.7±13.0 °C |
|---|
Names
| Name | ethynyl(triphenyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 365.2±15.0 °C at 760 mmHg |
|---|
| Melting Point | 48-50ºC(lit.) |
|---|
| Molecular Formula | C20H16Si |
|---|
| Molecular Weight | 284.427 |
|---|
| Flash Point | 173.7±13.0 °C |
|---|
| Exact Mass | 284.102112 |
|---|
| LogP | 7.41 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | WADKYPSVXRWORK-UHFFFAOYSA-N |
|---|
| SMILES | C#C[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3.0 |
|---|
Synonyms
| silane,ethynyltriphenyl |
| silane, ethynyltriphenyl- |
| Aethinyl-triphenyl-silan |
| MFCD00075453 |
| ethynyl-triphenyl-silane |
| Benzene, 1,1',1''-(ethynylsilylidyne)tris- |
| Ethynyl(triphenyl)silane |
