Introduction：Basic information about CAS 3842-55-5|2-Chloro-4,6-diphenyl-1,3,5-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-4,6-diphenyl-1,3,5-triazine |
|---|
| CAS Number | 3842-55-5 | Molecular Weight | 267.713 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 485.1±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H10ClN3 | Melting Point | 138-140℃ |
|---|
| MSDS | / | Flash Point | 279.2±9.6 °C |
|---|
Names
| Name | 2-Chloro-4,6-diphenyl-1,3,5-triazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 485.1±28.0 °C at 760 mmHg |
|---|
| Melting Point | 138-140℃ |
|---|
| Molecular Formula | C15H10ClN3 |
|---|
| Molecular Weight | 267.713 |
|---|
| Flash Point | 279.2±9.6 °C |
|---|
| Exact Mass | 267.056335 |
|---|
| PSA | 38.67000 |
|---|
| LogP | 4.36 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | DDGPPAMADXTGTN-UHFFFAOYSA-N |
|---|
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
|---|
| Water Solubility | Soluble in toluene. |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2-chloro-4,6-diphenyl-[1,3,5]triazine |
| 2-Chloro-4,6-diphenyl-1,3,5-triazine |
| chloro-diphenyl-[1,3,5]triazine |
| 1,3,5-Triazine,2-chloro-4,6-diphenyl |
| 2-CHLORO-4,6-DIPHENYL-S-TRIAZINE |
| 2-chloro-4,6-bisphenyl-1,3,5-triazine |
| 2-Chlor-4,6-diphenyl-triazin |
| 2,4-diphenyl-6-chloro-s-triazine |
| 1,3,5-Triazine, 2-chloro-4,6-diphenyl- |
| Diphenyl chloro-s-triazine |
