Introduction：Basic information about CAS 28987-59-9|3-Chloro-4-nitroanisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Chloro-4-nitroanisole |
|---|
| CAS Number | 28987-59-9 | Molecular Weight | 187.580 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 302.5±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.7±22.3 °C |
|---|
Names
| Name | 2-chloro-4-methoxy-1-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 302.5±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO3 |
|---|
| Molecular Weight | 187.580 |
|---|
| Flash Point | 136.7±22.3 °C |
|---|
| Exact Mass | 187.003616 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.65 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | QTIDRIQSPAELJC-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc([N+](=O)[O-])c(Cl)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene, 2-chloro-4-methoxy-1-nitro- |
| 2-chloro-4-methoxy nitrobenzene |
| 2-Chloro-6-methoxy-3-nitrobenzene |
| 2-chloro-4-methoxy-1-nitro-benzene |
| 2-Chloro-4-methoxy-1-nitrobenzene |
| para-nitro-meta-chloroanisole |
| 3-Chloro-4-nitroanisole |
| 3-Chloro-4-nitrophenyl methyl ether |
