Introduction：Basic information about CAS 52080-57-6|Chloroprednisone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chloroprednisone |
|---|
| CAS Number | 52080-57-6 | Molecular Weight | 392.87300 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 608.4ºC at 760mmHg |
|---|
| Molecular Formula | C21H25ClO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 321.8ºC |
|---|
Names
| Name | (6S,8S,9S,10R,13S,14S,17R)-6-chloro-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 608.4ºC at 760mmHg |
|---|
| Molecular Formula | C21H25ClO5 |
|---|
| Molecular Weight | 392.87300 |
|---|
| Flash Point | 321.8ºC |
|---|
| Exact Mass | 392.13900 |
|---|
| PSA | 91.67000 |
|---|
| LogP | 1.98310 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | NPSLCOWKFFNQKK-ZPSUVKRCSA-N |
|---|
| SMILES | CC12C=CC(=O)C=C1C(Cl)CC1C2C(=O)CC2(C)C1CCC2(O)C(=O)CO |
|---|
Synonyms
| chloroprednisone |
| Chloroprednisonum |
| Cloroprednisona |
| Chlorprednisonum |
| Cloroprednisone |
| Cloroprednisone [DCIT] |
| 6|A-Chloro Prednisone |
| UNII-564IBO56IP |
| 6Alpha-Chloro Prednisone |
