Introduction：Basic information about CAS 5696-09-3|proxazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | proxazole |
|---|
| CAS Number | 5696-09-3 | Molecular Weight | 287.40000 |
|---|
| Density | 1.034g/cm3 | Boiling Point | 407.1ºC at 760mmHg |
|---|
| Molecular Formula | C17H25N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200ºC |
|---|
Names
| Name | proxazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.034g/cm3 |
|---|
| Boiling Point | 407.1ºC at 760mmHg |
|---|
| Molecular Formula | C17H25N3O |
|---|
| Molecular Weight | 287.40000 |
|---|
| Flash Point | 200ºC |
|---|
| Exact Mass | 287.20000 |
|---|
| PSA | 42.16000 |
|---|
| LogP | 3.49580 |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | OLTAWOVKGWWERU-UHFFFAOYSA-N |
|---|
| SMILES | CCC(c1ccccc1)c1noc(CCN(CC)CC)n1 |
|---|
Synonyms
| diethyl-[2-[3-(1-phenylpropyl)-1,2,4-oxadiazol-5-yl]ethyl]amine |
| propaxoline |
| Aerbron |
| N,N-Diethyl-3-(1-phenylpropyl)-1,2,4-oxadiazole-5-ethan-1-amine |
| N,N-diethyl-2-[3-(1-phenylpropyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| 5-<2-Diaethylamino-aethyl>-3-<1-phenyl-propyl>-1.2.4-oxadiazol |
| (+)-Proxazol |
