Introduction：Basic information about CAS 23162-64-3|1,1,1,3,3,3-Hexabromoacetone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,1,3,3,3-Hexabromoacetone |
|---|
| CAS Number | 23162-64-3 | Molecular Weight | 531.45600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C3Br6O | Melting Point | 108-111ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1,1,1,3,3,3-hexabromopropan-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 108-111ºC |
|---|
| Molecular Formula | C3Br6O |
|---|
| Molecular Weight | 531.45600 |
|---|
| Exact Mass | 525.50500 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.23250 |
|---|
| InChIKey | IHAWQAMKUMLDIT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(C(Br)(Br)Br)C(Br)(Br)Br |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
|---|
| Risk Phrases | 22-51/53 |
|---|
| Safety Phrases | 24/25-61 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
Synonyms
| 2-Propanone,hexabromo-(6CI) |
| Hexabrom-aceton |
| Hexabrompropanon |
| Perbromaceton |
| 2-Propanone,1,1,1,3,3,3-hexabromo |
| 1,1,1,3,3,3-HEXABROMOACETONE |
| 1,1,1,3,3,3-hexabromo-propan-2-one |
| Hexabromoacetone |
