Introduction：Basic information about CAS 81353-09-5|O-Desacetyl-N-desmethyl Diltiazem, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | O-Desacetyl-N-desmethyl Diltiazem |
|---|
| CAS Number | 81353-09-5 | Molecular Weight | 358.45500 |
|---|
| Density | 1.239g/cm3 | Boiling Point | 612ºC at 760 mmHg |
|---|
| Molecular Formula | C19H22N2O3S | Melting Point | 134-136ºC (dec.) |
|---|
| MSDS | / | Flash Point | 323.9ºC |
|---|
Names
| Name | O-Desacetyl-N-desmethyl Diltiazem |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.239g/cm3 |
|---|
| Boiling Point | 612ºC at 760 mmHg |
|---|
| Melting Point | 134-136ºC (dec.) |
|---|
| Molecular Formula | C19H22N2O3S |
|---|
| Molecular Weight | 358.45500 |
|---|
| Flash Point | 323.9ºC |
|---|
| Exact Mass | 358.13500 |
|---|
| PSA | 87.10000 |
|---|
| LogP | 2.91140 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | HNXJRKQNTGIDDU-UHFFFAOYSA-N |
|---|
| SMILES | CNCCN1C(=O)C(O)C(c2ccc(OC)cc2)Sc2ccccc21 |
|---|
Synonyms
| Deacetyl N-Monodesmethyl Diltiazem |
| 3-Hydroxy-2-(4-methoxy-phenyl)-5-(2-methylamino-ethyl)-2,3-dihydro-5H-benzo[b][1,4]thiazepin-4-one |
| 3c-hydroxy-2r-(4-methoxy-phenyl)-5-(2-methylamino-ethyl)-2,3-dihydro-5H-benzo[b][1,4]thiazepin-4-one |
| Diltiazem Impurity 7 |
