Introduction：Basic information about CAS 930111-06-1|(2,3,4,5,6-pentafluorophenyl) 1-(thiophen-2-ylmethyl)piperidine-4-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,3,4,5,6-pentafluorophenyl) 1-(thiophen-2-ylmethyl)piperidine-4-carboxylate |
|---|
| CAS Number | 930111-06-1 | Molecular Weight | 391.35600 |
|---|
| Density | 1.452g/cm3 | Boiling Point | 408.6ºC at 760 mmHg |
|---|
| Molecular Formula | C17H14F5NO2S | Melting Point | 73-75ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2,3,4,5,6-pentafluorophenyl) 1-(thiophen-2-ylmethyl)piperidine-4-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.452g/cm3 |
|---|
| Boiling Point | 408.6ºC at 760 mmHg |
|---|
| Melting Point | 73-75ºC |
|---|
| Molecular Formula | C17H14F5NO2S |
|---|
| Molecular Weight | 391.35600 |
|---|
| Exact Mass | 391.06700 |
|---|
| PSA | 57.78000 |
|---|
| LogP | 4.19910 |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | ZANIAEUMQOHKCJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)C1CCN(Cc2cccs2)CC1 |
|---|
