Introduction:Basic information about CAS 56915-80-1|1-[3-(4-Methyl-1-piperazinyl)phenyl]ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-[3-(4-Methyl-1-piperazinyl)phenyl]ethanone |
|---|
| CAS Number | 56915-80-1 | Molecular Weight | 218.295 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 361.5±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.7±18.9 °C |
|---|
Names
| Name | 1-[3-(4-methylpiperazin-1-yl)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 361.5±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18N2O |
|---|
| Molecular Weight | 218.295 |
|---|
| Flash Point | 156.7±18.9 °C |
|---|
| Exact Mass | 218.141907 |
|---|
| PSA | 23.55000 |
|---|
| LogP | 1.25 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | UOADBNQWYZHSLK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cccc(N2CCN(C)CC2)c1 |
|---|
Synonyms
| m-(4-methyl-1-piperazinyl)acetophenone |
| 1-[3-(4-Methyl-1-piperazinyl)phenyl]ethanone |
| Ethanone, 1-[3-(4-methyl-1-piperazinyl)phenyl]- |
| 1-[3-(4-METHYL-PIPERAZIN-1-YL)-PHENYL]-ETHANONE |
| 1-[3-(4-Methyl-piperazin-1-yl)-phenyl]-; ethanone |
| m-<4-Methyl-1-piperazinyl>acetophenon |
| 1-(3-acetylphenyl)-4-methylpiperazine |