Introduction:Basic information about CAS 2213-81-2|4-tert-Butyl-2,6-dinitrochlorobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-Butyl-2,6-dinitrochlorobenzene |
|---|
| CAS Number | 2213-81-2 | Molecular Weight | 258.65800 |
|---|
| Density | 1.348 g/cm3 | Boiling Point | 317.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H11ClN2O4 | Melting Point | 113-115ºC |
|---|
| MSDS | / | Flash Point | 145.9ºC |
|---|
Names
| Name | 5-tert-butyl-2-chloro-1,3-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.348 g/cm3 |
|---|
| Boiling Point | 317.7ºC at 760 mmHg |
|---|
| Melting Point | 113-115ºC |
|---|
| Molecular Formula | C10H11ClN2O4 |
|---|
| Molecular Weight | 258.65800 |
|---|
| Flash Point | 145.9ºC |
|---|
| Exact Mass | 258.04100 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 4.50030 |
|---|
| Vapour Pressure | 0.000706mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | FRFMLDNFLXIDSH-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2,6-dinitro-4-tert-butylchlorobenzene |
| 2,6-dinitro-4-t-butyl-1-chlorobenzene |
| 5-tert-butyl-2-chloro-1,3-dinitro-benzene |
| 2-CHLORO-5-(1,1-DIMETHYLETHYL)-1,3-DINITROBENZENE |
| 4-t-Butyl-2,6-dinitrochlorobenzene |
| 2,6-dinitro-4-tert-butylphenyl chloride |
| 2-chloro-5-tert-butyl-1,3-dinitrobenzene |
| 4-tert-Butyl-2,6-dinitrochlorobenzene |