Introduction：Basic information about CAS 102-23-8|m-[(p-Aminophenyl)azo]benzenesulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | m-[(p-Aminophenyl)azo]benzenesulphonic acid |
|---|
| CAS Number | 102-23-8 | Molecular Weight | 277.29900 |
|---|
| Density | 1.43 | Boiling Point | / |
|---|
| Molecular Formula | C12H11N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-[(4-aminophenyl)diazenyl]benzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43 |
|---|
| Molecular Formula | C12H11N3O3S |
|---|
| Molecular Weight | 277.29900 |
|---|
| Exact Mass | 277.05200 |
|---|
| PSA | 113.49000 |
|---|
| LogP | 4.59290 |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | BATBWCBBYMPOPE-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(N=Nc2cccc(S(=O)(=O)O)c2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4'-Amino-azobenzol-sulfonsaeure-(3) |
| m-((p-Aminophenyl)azo)benzenesulphonic acid |
| m-[(p-aminophenyl)azo]benzenesulfonic acid |
| 4-aminoazobenzene-3'-sulfonic acid |
| 3-(4-Amino-phenylazo)-benzolsulfonsaeure |
| 4-Amino-azobenzol-3'-sulfonsaeure |
| 3-(4-amino-phenylazo)-benzenesulfonic acid |
| EINECS 203-015-2 |
| (Benzol-sulfonsaeure-(1))-(3 azo 4)-anilin |
